Introduction:Basic information about CAS 104960-50-1|2-mercapto-6-thien-2-yl-4-(trifluoromethyl)-pyridine-3-carbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-mercapto-6-thien-2-yl-4-(trifluoromethyl)-pyridine-3-carbonitrile |
|---|
| CAS Number | 104960-50-1 | Molecular Weight | 286.29600 |
|---|
| Density | 1.54g/cm3 | Boiling Point | 322.6ºC at 760mmHg |
|---|
| Molecular Formula | C11H5F3N2S2 | Melting Point | 149ºC |
|---|
| MSDS | / | Flash Point | 148.9ºC |
|---|
Names
| Name | 2-sulfanylidene-6-thiophen-2-yl-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.54g/cm3 |
|---|
| Boiling Point | 322.6ºC at 760mmHg |
|---|
| Melting Point | 149ºC |
|---|
| Molecular Formula | C11H5F3N2S2 |
|---|
| Molecular Weight | 286.29600 |
|---|
| Flash Point | 148.9ºC |
|---|
| Exact Mass | 285.98500 |
|---|
| PSA | 103.72000 |
|---|
| LogP | 3.98928 |
|---|
| Vapour Pressure | 4.24E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | NRRMGADRBHVSNC-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1c(C(F)(F)F)cc(-c2cccs2)[nH]c1=S |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3439 |
|---|
Synonyms
| 6-(2-thienyl)-2-thioxo-4-(trifluoromethyl)hydropyridine-3-carbonitrile |
| 2-sulfanyl-6-(thiophen-2-yl)-4-(trifluoromethyl)pyridine-3-carbonitrile |
| 4-(trifluoromethyl)-1,2-dihydro-6-(thiophen-2-yl)-2-thioxopyridine-3-carbonitrile |
| HMS558B19 |
| 3-cyano-6-(2-thienyl)-4-trifluoromethylpyridine-2(1H)-thione |