Introduction:Basic information about CAS 56211-70-2|N,N,N-Tripropyl-1-propanaminium hydrogen sulfate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N,N-Tripropyl-1-propanaminium hydrogen sulfate |
|---|
| CAS Number | 56211-70-2 | Molecular Weight | 283.428 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H29NO4S | Melting Point | 158-160 °C |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | hydrogen sulfate,tetrapropylazanium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 158-160 °C |
|---|
| Molecular Formula | C12H29NO4S |
|---|
| Molecular Weight | 283.428 |
|---|
| Exact Mass | 283.181732 |
|---|
| PSA | 85.81000 |
|---|
| LogP | 3.52860 |
|---|
| InChIKey | MOXJKKOSZCHGEU-UHFFFAOYSA-M |
|---|
| SMILES | CCC[N+](CCC)(CCC)CCC.O=S(=O)([O-])O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2923900090 |
|---|
Customs
| HS Code | 2923900090 |
|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Tetrapropyl ammonium hydrogen sulphate |
| Tetra-n-propylammonium hydrogen sulfate |
| Tetrapropylammonium bisulfate |
| MFCD00038764 |
| N,N,N-Tripropyl-1-propanaminium hydrogen sulfate |
| Tetrapropylammonium hydrogen sulfate |