Introduction：Basic information about CAS 2359-15-1|2-Propenamide,N,N'-methylenebis[2-methyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Propenamide,N,N'-methylenebis[2-methyl- |
|---|
| CAS Number | 2359-15-1 | Molecular Weight | 182.22000 |
|---|
| Density | 1.019g/cm3 | Boiling Point | 443.1ºC at 760mmHg |
|---|
| Molecular Formula | C9H14N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.6ºC |
|---|
Names
| Name | 2-methyl-N-[(2-methylprop-2-enoylamino)methyl]prop-2-enamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.019g/cm3 |
|---|
| Boiling Point | 443.1ºC at 760mmHg |
|---|
| Molecular Formula | C9H14N2O2 |
|---|
| Molecular Weight | 182.22000 |
|---|
| Flash Point | 198.6ºC |
|---|
| Exact Mass | 182.10600 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 1.11030 |
|---|
| Vapour Pressure | 4.77E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.472 |
|---|
| InChIKey | TURITJIWSQEMDB-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C(=O)NCNC(=O)C(=C)C |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2924199090 |
|---|
Customs
| HS Code | 2924199090 |
|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| bis-methacryloylamino-methane |
| N,N'-Methylenebismethacrylamide |
| N,N'-Methylenebis(2-methyl-2-propenamide) |
| 2-Propenamide,N,N'-methylenebis(2-methyl |
| n,n'-methylenebis(2-methylacrylamide) |
| N,N'-Dimethacryloyl-methylendiamin |
| EINECS 219-102-3 |
| N,N'-methylenebisacrylamide |
| Bis-methacryloylamino-methan |
