Introduction:Basic information about CAS 41613-26-7|2,4(1H,3H)-Pyrimidinedione,1,3-dimethyl-5-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4(1H,3H)-Pyrimidinedione,1,3-dimethyl-5-nitro- |
|---|
| CAS Number | 41613-26-7 | Molecular Weight | 203.15300 |
|---|
| Density | 1.51 g/cm3 | Boiling Point | 262.7ºC at 760 mmHg |
|---|
| Molecular Formula | C6H9N3O5 | Melting Point | 155-160ºC(lit.) |
|---|
| MSDS | / | Flash Point | 112.7ºC |
|---|
Names
| Name | 1,3-dimethyl-5-nitrouracil hydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.51 g/cm3 |
|---|
| Boiling Point | 262.7ºC at 760 mmHg |
|---|
| Melting Point | 155-160ºC(lit.) |
|---|
| Molecular Formula | C6H9N3O5 |
|---|
| Molecular Weight | 203.15300 |
|---|
| Flash Point | 112.7ºC |
|---|
| Exact Mass | 203.05400 |
|---|
| PSA | 99.05000 |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | SDLBIQNBDPOOPJ-UHFFFAOYSA-N |
|---|
| SMILES | Cn1cc([N+](=O)[O-])c(=O)n(C)c1=O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,3-dimethyl-5-nitro-2,4(1H,3H)pyrimidinedione |
| 1,3-DIMETHYL-5-NITROURACIL MONOHYDRATE |
| 5-Nitro-1,3-dimethyluracil |
| EINECS 255-462-8 |
| 1,3-dimethyl-5-nitrouracil |
| N,N-dimethyl-5-nitrouracil |
| nitro-5 dimethyl-1,3 uracile |
| 1,3-Dimethyl-5-nitro-1H-pyrimidin-2,4-dion |
| 1,3-dimethyl-5-nitro-1H-pyrimidine-2,4-dione |