Introduction：Basic information about CAS 69045-83-6|2,3-Dichloro-5-(trichloromethyl)pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3-Dichloro-5-(trichloromethyl)pyridine |
|---|
| CAS Number | 69045-83-6 | Molecular Weight | 265.35200 |
|---|
| Density | 1.636 | Boiling Point | 278-279ºC |
|---|
| Molecular Formula | C6H2Cl5N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150 °F |
|---|
Names
| Name | 2,3-Dichloro-5-(trichloromethyl)pyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.636 |
|---|
| Boiling Point | 278-279ºC |
|---|
| Molecular Formula | C6H2Cl5N |
|---|
| Molecular Weight | 265.35200 |
|---|
| Flash Point | 150 °F |
|---|
| Exact Mass | 262.86300 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.21510 |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | XVBWGQSXLITICX-UHFFFAOYSA-N |
|---|
| SMILES | Clc1cc(C(Cl)(Cl)Cl)cnc1Cl |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| MFCD03701543 |
| DSSTox_CID_9534 |
| 2,3,5-TRIFLUOROBENZOTRIFLUORIDE |
| 2,3-dichloro-5-(tri-chloromethyl)pyridine |
| Pyridine,2,3-dichloro-5-(trichloromethyl) |
| 5,6-dichloro-3-trichloromethyl pyridine |
