CAS 125995-13-3|(4R,6R)-tert-Butyl-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxane-4-acetate
Introduction：Basic information about CAS 125995-13-3|(4R,6R)-tert-Butyl-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxane-4-acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4R,6R)-tert-Butyl-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxane-4-acetate | ||
|---|---|---|---|
| CAS Number | 125995-13-3 | Molecular Weight | 273.368 |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 339.8±17.0 °C at 760 mmHg |
| Molecular Formula | C14H27NO4 | Melting Point | / |
| MSDS | / | Flash Point | 96.8±17.3 °C |
Names
| Name | (4R,6R)-tert-Butyl-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxane-4-acetate |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 339.8±17.0 °C at 760 mmHg |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.368 |
| Flash Point | 96.8±17.3 °C |
| Exact Mass | 273.194000 |
| PSA | 70.78000 |
| LogP | 1.38 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.446 |
| InChIKey | HWSHVKNLMBMKSR-GHMZBOCLSA-N |
| SMILES | CC(C)(C)OC(=O)CC1CC(CCN)OC(C)(C)O1 |
| Storage condition | Refrigerator |
Safety Information
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S24/25 |
| HS Code | 2932999099 |
Customs
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
Synonyms
| (4R-cis)-1,1-dimethylethyl-[6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| Atorvastatin Intermediate 1 |
| 3-dioxane-4-acetate |
| tert-Butyl 2-[(4R,6R)-6-(2-Aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| (4R,6R)-Tert-Butyl-6-(2-Aminoe |
| 6R)-tert-Butyl-6-(2-aMinoethyl)-2 |
| 2-Methyl-2-propanyl [(4R,6R)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| 4R,6R)-tert-Butyl-6-(2-aMinoethyl)-2,2-diMethyl-1 |
| (4R,Cis)-1,1-diMethylethyl6-aMinoethyl |
| tert-butyl [(4R,6R)-6-aminoethyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| (4R-cis)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic acid 1,1-dimethylethyl ester |
| Tert-butyl[(4R,6R)-6-(2-aminoethyl)-2,2-dimethyl-1, 3-dioxan-4-yl]acetate |
| [(4R,6R)-6-(2-Amino-ethyl)-2,2-dimethyl-[1,3]dioxan-4-yl]-acetic acid tert-butyl ester |
| 2-[(4R,6R)-6-(2-Aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic Acid tert-Butyl Ester |
| tert-Butyl [(4R,6R)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| tert-Butyl 6-aminoethyl-2,2-dimethyl-1,3-dioxolane-4-acetate |
| (4R-cis)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxane-4-acetic acid tertiary butyl ester |
| ATS-9 |
| 2-diMethyl-1 |
| tert-butyl 2-((4R,6R)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl)acetate |
| MFCD07369252 |
| 1,3-Dioxane-4-acetic acid, 6-(2-aminoethyl)-2,2-dimethyl-, 1,1-dimethylethyl ester, (4R,6R)- |
| tert-butyl ((4R,6R)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxane-4-yl)acetate |
