Introduction：Basic information about CAS 24262-38-2|D-3-Bromocamphor-10-sulfonic acid monohydrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | D-3-Bromocamphor-10-sulfonic acid monohydrate |
|---|
| CAS Number | 24262-38-2 | Molecular Weight | 329.208 |
|---|
| Density | 1.647 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H17BrO5S | Melting Point | 117-121°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2-bromo-7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.647 g/cm3 |
|---|
| Melting Point | 117-121°C |
|---|
| Molecular Formula | C10H17BrO5S |
|---|
| Molecular Weight | 329.208 |
|---|
| Exact Mass | 327.997986 |
|---|
| PSA | 89.05000 |
|---|
| LogP | 2.65950 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | XUJHKPSBHDQIOD-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2Br |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | 2585 |
|---|
Synonyms
| Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 3-bromo-7,7-dimethyl-2-oxo-, hydrate (1:1) |
| (3-bromo-7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl)methanesulfonic acid |
| (3-Bromo-7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl)methanesulfonic acid hydrate (1:1) |
| MFCD00209633 |
| EINECS 246-114-6 |
