Introduction:Basic information about CAS 17814-85-6|(4-Carboxybutyl)triphenylphosphonium bromide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-Carboxybutyl)triphenylphosphonium bromide |
|---|
| CAS Number | 17814-85-6 | Molecular Weight | 443.313 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C23H24BrO2P | Melting Point | 204-207 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-carboxybutyl(triphenyl)phosphanium,bromide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 204-207 °C(lit.) |
|---|
| Molecular Formula | C23H24BrO2P |
|---|
| Molecular Weight | 443.313 |
|---|
| Exact Mass | 442.069733 |
|---|
| PSA | 50.89000 |
|---|
| LogP | 1.23940 |
|---|
| InChIKey | MLOSJPZSZWUDSK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
|---|
| Storage condition | Refrigerator |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | 3278 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 29310095 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-(Carboxybutyl)triphenylphosphonium Bromide |
| (4-Carboxybutyl)(triphenyl)phosphonium bromide |
| Ph3P(1+)(CH2)4COOH*Br(1-) |
| 5-(Triphenylphosphonio)pentanoic acid bromide,Carboxybutyltriphenylphosphonium bromide |
| Ph3P(+)Br(-)(CH2)4CO2H |
| (4-carboxybutyl)triphenylphosphanium bromide |
| 4-carboxy-n-butyltriphenylphosphonium bromide |
| Phosphonium, (4-carboxybutyl)triphenyl-, bromide |
| (5-hydroxy-5-oxopentyl)-triphenylphosphanium bromide |
| EINECS 241-782-5 |
| MFCD00011906 |
| 4-hydroxycarbonylbutyltriphenylphosphonium bromide |
| Phosphonium, (4-carboxybutyl)triphenyl-, bromide (1:1) |
| BrPh3PCH2(CH2)3COOH |
| Phosphonium,(4-carboxybutyl)triphenyl-,bromide |
| triphenyl-(4-carboxybutyl)-phosphoniumbromide |
| (4-Carboxybutyl)Triphenylphosphonium Bromide |