Introduction：Basic information about CAS 1700-02-3|2,4-Dichloro-6-phenyl-1,3,5-triazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-Dichloro-6-phenyl-1,3,5-triazine |
|---|
| CAS Number | 1700-02-3 | Molecular Weight | 226.062 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 427.5±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H5Cl2N3 | Melting Point | 121 °C |
|---|
| MSDS | / | Flash Point | 244.9±9.6 °C |
|---|
Names
| Name | 2,4-Dichloro-6-phenyl-1,3,5-triazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 427.5±28.0 °C at 760 mmHg |
|---|
| Melting Point | 121 °C |
|---|
| Molecular Formula | C9H5Cl2N3 |
|---|
| Molecular Weight | 226.062 |
|---|
| Flash Point | 244.9±9.6 °C |
|---|
| Exact Mass | 224.986053 |
|---|
| PSA | 38.67000 |
|---|
| LogP | 3.18 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.610 |
|---|
| InChIKey | AMEVJOWOWQPPJQ-UHFFFAOYSA-N |
|---|
| SMILES | Clc1nc(Cl)nc(-c2ccccc2)n1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933699090 |
|---|
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 2-phenyl-4,6-dichloro-1,3,5-triazine |
| 2-phenyl-4,6-dichloro-s-triazine |
| Dichlor-phenyl-[1,3,5]triazin |
| MFCD00602464 |
| EINECS 216-928-6 |
| 1,3,5-Triazine, 2,4-dichloro-6-phenyl- |
| 2,4-Dichloro-6-phenyl-1,3,5-triazine |
| 2,4-dichloro-6-phenyltriazine |
| 2,4-dichloro-6-phenyl-[1,3,5]triazine |
| 6-phenyl-2,4-dichloro-triazine |
| 2,4-DICHLORO-6-PHENYL-S-TRIAZINE |
