Introduction：Basic information about CAS 10387-49-2|(2-oxochromen-7-yl) acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2-oxochromen-7-yl) acetate |
|---|
| CAS Number | 10387-49-2 | Molecular Weight | 204.17900 |
|---|
| Density | 1.319g/cm3 | Boiling Point | 366.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.5ºC |
|---|
Names
| Name | (2-oxochromen-7-yl) acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.319g/cm3 |
|---|
| Boiling Point | 366.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8O4 |
|---|
| Molecular Weight | 204.17900 |
|---|
| Flash Point | 191.5ºC |
|---|
| Exact Mass | 204.04200 |
|---|
| PSA | 56.51000 |
|---|
| LogP | 1.71830 |
|---|
| Vapour Pressure | 1.44E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | MGZOXZPZHVOXQB-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1ccc2ccc(=O)oc2c1 |
|---|
Safety Information
Customs
| HS Code | 2932209090 |
|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 7-acetyloxycoumarin |
| 2-oxo-2H-chromen-7-yl acetate |
| Acetylumbelliferone |
| 2-oxo-2H-7-chromenyl acetate |
| 7-acetoxycoumarin |
| Bio-0211 |
| 7-acetylumbelliferone |
| 2-oxochromen-7-yl acetate |
| 7-O-Acetylcoumarin |
| 7-acetoxy-2H-1-benzopyran-2-one |
| 7-acetoxy-2H-chromen-2-one |
