Introduction:Basic information about CAS 10425-11-3|(3,4-Dihydroxyphenyl)(phenyl)methanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3,4-Dihydroxyphenyl)(phenyl)methanone |
|---|
| CAS Number | 10425-11-3 | Molecular Weight | 214.217 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 433.8±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H10O3 | Melting Point | 144-148 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 230.3±22.4 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3,4-Dihydroxybenzophenone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 433.8±35.0 °C at 760 mmHg |
|---|
| Melting Point | 144-148 °C(lit.) |
|---|
| Molecular Formula | C13H10O3 |
|---|
| Molecular Weight | 214.217 |
|---|
| Flash Point | 230.3±22.4 °C |
|---|
| Exact Mass | 214.062988 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 2.56 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.648 |
|---|
| InChIKey | ARWCZKJISXFBGI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccccc1)c1ccc(O)c(O)c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2914501900 |
|---|
Customs
| HS Code | 2914501900 |
|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 4-Benzoylpyrocatechol |
| 3,4-dihydroxybnezophenone |
| MFCD00477203 |
| (3,4-Dihydroxyphenyl)(phenyl)methanone |
| 3,4-Dihydroxy-diphenyl ketone |
| 4-benzoylbenzene-1,2-diol |
| Methanone, (3,4-dihydroxyphenyl)phenyl- |
| 3,4-dihydroxy benzophonone |
| (3,4-Dihydroxyphenyl)phenylmethanone |
| 4-Benzoyl-brenzcatechin |
| 4-benzoylcatechol |
| 3,4-Dihydroxy-benzophenon |
| 3,4-Dihydroxybenzoph |