Introduction：Basic information about CAS 6628-86-0|5-Chloro-2-nitrobenzaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Chloro-2-nitrobenzaldehyde |
|---|
| CAS Number | 6628-86-0 | Molecular Weight | 185.565 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 310.2±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H4ClNO3 | Melting Point | 65-69 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 141.4±23.7 °C |
|---|
| Symbol |
GHS05, GHS07, GHS09 | Signal Word | Danger |
|---|
Names
| Name | 5-Chloro-2-nitrobenzaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 310.2±27.0 °C at 760 mmHg |
|---|
| Melting Point | 65-69 °C(lit.) |
|---|
| Molecular Formula | C7H4ClNO3 |
|---|
| Molecular Weight | 185.565 |
|---|
| Flash Point | 141.4±23.7 °C |
|---|
| Exact Mass | 184.987976 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 2.41 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | SWGPIDCNYAYXMJ-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1cc(Cl)ccc1[N+](=O)[O-] |
|---|
Safety Information
| Symbol |
GHS05, GHS07, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H290-H315-H317-H318-H335-H400 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 + P310 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | Xi,C,F |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S22-S24/25-S36/37-S26 |
|---|
| RIDADR | UN3077 9/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2913000090 |
|---|
Customs
| HS Code | 2913000090 |
|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| EINECS 229-614-9 |
| 6-nitro-3-chlorobenzaldehyde |
| 5-Chloro-2-nitrobenzaldehyde |
| 5-chloro-2-nitrobenzaldehdye |
| 5-chloro-2-nitrobenxaldehyde |
| 5-chloro-2-nitro-benzaldehyde |
| 2-Nitro-5-chlorobenzaldehyde |
| 3-chloro-6-nitrobenzaldehyde |
| MFCD00007289 |
| Benzaldehyde, 5-chloro-2-nitro- |
| 4-Chloro-2-formylnitrobenzene |
