Introduction：Basic information about CAS 94348-92-2|potassium pentamethylcyclopentadienide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | potassium pentamethylcyclopentadienide |
|---|
| CAS Number | 94348-92-2 | Molecular Weight | 174.32400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H15K | Melting Point | >230ºC(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | potassium pentamethylcyclopentadienide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | >230ºC(lit.) |
|---|
| Molecular Formula | C10H15K |
|---|
| Molecular Weight | 174.32400 |
|---|
| Exact Mass | 174.08100 |
|---|
| LogP | 3.40070 |
|---|
| InChIKey | CNTPKXIECBGFKF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[K+] |
|---|
Safety Information
| Hazard Codes | F: Flammable; |
|---|
| Risk Phrases | 34-17-15 |
|---|
| Safety Phrases | 45-43-36/37/39-26-24-16-6 |
|---|
| RIDADR | UN 3393 4.2/PG 1 |
|---|
Synonyms
| kpaba |
| 4-Aminobenzoic acid potassium salt |
| Potassium 1,2,3,4,5-pentamethyl-2,4-cyclopentadienide |
| potassium p-aminobenzoate |
| potassium salt of para amino benzoic acid |
| para-aminobenzoic acid potassium salt |
| MFCD00799575 |
| potassium pentamethylcyclopentadienyl |
| p-Aminobenzoic acid potassium salt |
| Potassium 4-aminobenzoate |
| pentamethylcyclopentadienyl potassium |
| Pentamethylcyclopentadienyl-Kalium |
| Aminobenzoate potassium |
| potassium pentamethylcyclopentadiene |
| pentamethylcyclopentadienyl potasssium |
