Introduction：Basic information about CAS 607-32-9|5-Nitroisoquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Nitroisoquinoline |
|---|
| CAS Number | 607-32-9 | Molecular Weight | 174.156 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 340.5±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6N2O2 | Melting Point | 106-109 °C(lit.) |
|---|
| MSDS | / | Flash Point | 159.7±20.9 °C |
|---|
Names
| Name | 5-Nitroisoquinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 340.5±17.0 °C at 760 mmHg |
|---|
| Melting Point | 106-109 °C(lit.) |
|---|
| Molecular Formula | C9H6N2O2 |
|---|
| Molecular Weight | 174.156 |
|---|
| Flash Point | 159.7±20.9 °C |
|---|
| Exact Mass | 174.042923 |
|---|
| PSA | 58.71000 |
|---|
| LogP | 1.69 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.682 |
|---|
| InChIKey | PYGMPFQCCWBTJQ-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc2cnccc12 |
|---|
Safety Information
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22;R38 |
|---|
| Safety Phrases | S26-S37/39-S36/37/39 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933499090 |
|---|
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-Nitroisoquinoline |
| Isoquinoline,5-nitro |
| EINECS 210-133-8 |
| MFCD00006905 |
| 5-NO2-isoquinoline |
| 5-nitro isoquinoline |
| 5-nitroisochinolin |
| Isoquinoline, 5-nitro- |
