Introduction：Basic information about CAS 104267-73-4|9-Nitro-10-hydroxy camptothecin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9-Nitro-10-hydroxy camptothecin |
|---|
| CAS Number | 104267-73-4 | Molecular Weight | 409.34900 |
|---|
| Density | 1.71g/cm3 | Boiling Point | 825.3ºC at 760mmHg |
|---|
| Molecular Formula | C20H15N3O7 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 452.9ºC |
|---|
Names
| Name | 10-hydroxy-9-nitrocamptothecin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.71g/cm3 |
|---|
| Boiling Point | 825.3ºC at 760mmHg |
|---|
| Molecular Formula | C20H15N3O7 |
|---|
| Molecular Weight | 409.34900 |
|---|
| Flash Point | 452.9ºC |
|---|
| Exact Mass | 409.09100 |
|---|
| PSA | 147.47000 |
|---|
| LogP | 2.21660 |
|---|
| Vapour Pressure | 7.58E-29mmHg at 25°C |
|---|
| Index of Refraction | 1.791 |
|---|
| InChIKey | DTZABKRGTMUGCV-FQEVSTJZSA-N |
|---|
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c([N+](=O)[O-])c(O)ccc3nc2-1 |
|---|
Synonyms
| 9-Nitro-10-Hydroxy camptothecin |
| 9-Hydroxy-10-nitrocamptothecin |
| 9-nitro-10-hydroxy-20(S)-camptothecin |
| (4S)-4-Ethyl-4,9-dihydroxy-10-nitro-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione |
