Introduction:Basic information about CAS 24870-10-8|n-(4-methoxyphenyl)maleamic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | n-(4-methoxyphenyl)maleamic acid |
|---|
| CAS Number | 24870-10-8 | Molecular Weight | 221.20900 |
|---|
| Density | 1.318g/cm3 | Boiling Point | 473ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 239.9ºC |
|---|
Names
| Name | n-(4-methoxyphenyl)maleamic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.318g/cm3 |
|---|
| Boiling Point | 473ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO4 |
|---|
| Molecular Weight | 221.20900 |
|---|
| Flash Point | 239.9ºC |
|---|
| Exact Mass | 221.06900 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 1.34750 |
|---|
| Vapour Pressure | 9.4E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | CCFLBHDPAUAJMZ-SREVYHEPSA-N |
|---|
| SMILES | COc1ccc(NC(=O)C=CC(=O)O)cc1 |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(4-Methoxyphenyl)maleamidic acid |
| (Z)-4-(4-methoxyphenylamino)-4-oxobut-2-enoic acid |
| 4-(4'-methoxy-phenylamino)-4-oxo-(Z)-2-butenoic acid |
| p-methoxy maleanilic acid |
| (Z)-4-(4-Methoxyphenylamino)-4-oxo-2-butenoic acid |
| N-(P-METHOXYPHENYL)MALEAMIC ACID |
| Maleic acid mono(4-methoxyphenyl)amide |
| 4-methoxymaleanilic acid |
| (Z)-4-Oxo-4-[(4-methoxyphenyl)amino]-2-butenoic acid |
| N-(p-anisoyl)maleamic acid |