Introduction：Basic information about CAS 5599-44-0|5-Benzyloxyindole-3-acetic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Benzyloxyindole-3-acetic acid methyl ester |
|---|
| CAS Number | 5599-44-0 | Molecular Weight | 295.33200 |
|---|
| Density | 1.233 g/cm3 | Boiling Point | 480.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H17NO3 | Melting Point | 69ºC ± 1ºC |
|---|
| MSDS | / | Flash Point | 244.6ºC |
|---|
Names
| Name | methyl 2-(5-phenylmethoxy-1H-indol-3-yl)acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.233 g/cm3 |
|---|
| Boiling Point | 480.8ºC at 760 mmHg |
|---|
| Melting Point | 69ºC ± 1ºC |
|---|
| Molecular Formula | C18H17NO3 |
|---|
| Molecular Weight | 295.33200 |
|---|
| Flash Point | 244.6ºC |
|---|
| Exact Mass | 295.12100 |
|---|
| PSA | 51.32000 |
|---|
| LogP | 3.46240 |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | CVNVZZJUGJPNON-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)Cc1c[nH]c2ccc(OCc3ccccc3)cc12 |
|---|
Synonyms
| methyl (5-benzyloxy-1H-indol-3-yl)acetate |
| AmbotzXAA1080 |
| (5-benzyloxy-indol-3-yl)-acetic acid methyl ester |
| methyl 5-benzyloxy-3-indole-acetate |
| 5-benzyloxy-3-carbomethoxymethylindole |
| 5-Benzyloxy-indolyl-3-essigsaeuremethylester |
| 5-benzyloxyindole-3acetic acid methyl ester |
