Introduction：Basic information about CAS 179101-81-6|Pyridalyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pyridalyl |
|---|
| CAS Number | 179101-81-6 | Molecular Weight | 491.11600 |
|---|
| Density | 1.45 | Boiling Point | 545.4ºC at 760mmHg |
|---|
| Molecular Formula | C18H14Cl4F3NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 283.7ºC |
|---|
Names
| Name | pyridalyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.45 |
|---|
| Boiling Point | 545.4ºC at 760mmHg |
|---|
| Molecular Formula | C18H14Cl4F3NO3 |
|---|
| Molecular Weight | 491.11600 |
|---|
| Flash Point | 283.7ºC |
|---|
| Exact Mass | 488.96800 |
|---|
| PSA | 40.58000 |
|---|
| LogP | 6.95290 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | AEHJMNVBLRLZKK-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)nc1 |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
Synonyms
| 2-(3-{2,6-dichloro-4-[(3,3-dichloroprop-2-en-1-yl)oxy]phenoxy}propoxy)-5-(trifluoromethyl)pyridine |
| 2-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-6-(trifluoromethyl)pyridine |
| Pyridine,2-(3-(2,6-dichloro-4-((3,3-dichloro-2-propenyl)oxy)phenoxy)propoxy)-5-(trifluoromethyl) |
| S 1812 |
| 2-[3-[2,6-dichloro-4-[(3,3-dichloro-2-propen-1-yl)oxy]phenoxy]propoxy]-5-(trifluoromethyl)pyridine |
| 2,6-dichloro-4-(3,3-dichloroallyloxy)phenyl 3-[5-(trifluoromethyl)-2-pyridyloxy]propyl ether |
| Pyridalyl [ISO] |
