Introduction:Basic information about CAS 1022-46-4|Bentranil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bentranil |
|---|
| CAS Number | 1022-46-4 | Molecular Weight | 223.22700 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 189-192ºC8 mm Hg(lit.) |
|---|
| Molecular Formula | C14H9NO2 | Melting Point | 123-125ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 163ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | bentranil |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 189-192ºC8 mm Hg(lit.) |
|---|
| Melting Point | 123-125ºC(lit.) |
|---|
| Molecular Formula | C14H9NO2 |
|---|
| Molecular Weight | 223.22700 |
|---|
| Flash Point | 163ºC |
|---|
| Exact Mass | 223.06300 |
|---|
| PSA | 43.10000 |
|---|
| LogP | 2.85500 |
|---|
| Vapour Pressure | 5.32E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | HTTLBYITFHMYFK-UHFFFAOYSA-N |
|---|
| SMILES | O=c1oc(-c2ccccc2)nc2ccccc12 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934999027 |
|---|
Customs
| HS Code | 2934999027 |
|---|
| Summary | 2934999027 3-isopropyl-1h-benzo[c][1,2,6]thiadiazin-4(3h)-one 2,2-dioxide。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
|---|
Synonyms
| 4H-3,1-BENZOXAZIN-4-ONE,2-PHENYL |
| 2-phenyl-3,1-benzoxazin-4-one |
| MFCD00043598 |
| Bentranil |
| 2-phenyl-1,2-dihydro-4H-3,1-benzoxazin-4-one |
| Linurotox |
| Linarotox |
| 2-phenylbenzoxazinone |
| 2-phenyl-4H-3,1-benzoxazin-4-one |
| H-170 |