Introduction：Basic information about CAS 415925-40-5|1-[4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]phenyl]ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]phenyl]ethanone |
|---|
| CAS Number | 415925-40-5 | Molecular Weight | 295.37900 |
|---|
| Density | 1.154g/cm3 | Boiling Point | 466.6ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 236ºC |
|---|
Names
| Name | 1-[4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]phenyl]ethanone |
|---|
Chemical & Physical Properties
| Density | 1.154g/cm3 |
|---|
| Boiling Point | 466.6ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21N3O |
|---|
| Molecular Weight | 295.37900 |
|---|
| Flash Point | 236ºC |
|---|
| Exact Mass | 295.16800 |
|---|
| PSA | 36.44000 |
|---|
| LogP | 2.60930 |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | DWPPWLCWPIDJKH-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc(N2CCN(Cc3ccccn3)CC2)cc1 |
|---|
