Introduction:Basic information about CAS 223381-95-1|N-Acetyl-3-(4-(p-methoxyphenyl)piperazinyl)azetidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Acetyl-3-(4-(p-methoxyphenyl)piperazinyl)azetidine |
|---|
| CAS Number | 223381-95-1 | Molecular Weight | 289.37300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C16H23N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-Acetyl-3-(4-(p-methoxyphenyl)piperazinyl)azetidine |
|---|
Chemical & Physical Properties
| Molecular Formula | C16H23N3O2 |
|---|
| Molecular Weight | 289.37300 |
|---|
| Exact Mass | 289.17900 |
|---|
| PSA | 36.02000 |
|---|
| LogP | 0.98870 |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | QYNXRZLQTYRKBI-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(N2CCN(C3CN(C(C)=O)C3)CC2)cc1 |
|---|