Introduction：Basic information about CAS 3282-11-9|4,4''-Dinitro-p-terphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4''-Dinitro-p-terphenyl |
|---|
| CAS Number | 3282-11-9 | Molecular Weight | 320.299 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 534.4±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H12N2O4 | Melting Point | 277-278ºC |
|---|
| MSDS | / | Flash Point | 260.2±17.4 °C |
|---|
Names
| Name | 1,4-bis(4-nitrophenyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 534.4±30.0 °C at 760 mmHg |
|---|
| Melting Point | 277-278ºC |
|---|
| Molecular Formula | C18H12N2O4 |
|---|
| Molecular Weight | 320.299 |
|---|
| Flash Point | 260.2±17.4 °C |
|---|
| Exact Mass | 320.079712 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 4.87 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | MHOAYDHUNGLDTB-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(-c3ccc([N+](=O)[O-])cc3)cc2)cc1 |
|---|
Safety Information
| Risk Phrases | R20/22 |
|---|
| Safety Phrases | S22-S36/37 |
|---|
| HS Code | 2904209090 |
|---|
Customs
| HS Code | 2904209090 |
|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 3,3'',5,5''-tetranitro-1,1':4',1''-terphenyl |
| 4,4''-Dinitro-p-terphenyl |
| 1,1':4',1''-Terphenyl, 4,4''-dinitro- |
| p-Terphenyl,4,4''-dinitro |
| 4,4′′-Dinitro-p-terphenyl |
| 4,4'-Dinitro-p-terphenyl |
| p,p"-dinitro-p-terphenyl |
| 4,4''-Dinitro-1,1':4',1''-terphenyl |
| p-Terphenyl, 4,4''-dinitro- |
| MFCD00051743 |
