Introduction：Basic information about CAS 883042-07-7|Benzonitrile, 4-[4-[[3-(2,6-dichlorophenyl)-5-methyl-4-isoxazolyl]carbonyl]-1-pipera, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzonitrile, 4-[4-[[3-(2,6-dichlorophenyl)-5-methyl-4-isoxazolyl]carbonyl]-1-piperazinyl]- |
|---|
| CAS Number | 883042-07-7 | Molecular Weight | 441.31000 |
|---|
| Density | 1.45g/cm3 | Boiling Point | 663.8ºC at 760 mmHg |
|---|
| Molecular Formula | C22H18Cl2N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 355.2ºC |
|---|
Names
| Name | Benzonitrile, 4-[4-[[3-(2,6-dichlorophenyl)-5-methyl-4-isoxazolyl]carbonyl]-1-piperazinyl] |
|---|
Chemical & Physical Properties
| Density | 1.45g/cm3 |
|---|
| Boiling Point | 663.8ºC at 760 mmHg |
|---|
| Molecular Formula | C22H18Cl2N4O2 |
|---|
| Molecular Weight | 441.31000 |
|---|
| Flash Point | 355.2ºC |
|---|
| Exact Mass | 440.08100 |
|---|
| PSA | 73.37000 |
|---|
| LogP | 4.79378 |
|---|
| Index of Refraction | 1.675 |
|---|
| InChIKey | GODHMDQTUWRHAD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)N1CCN(c2ccc(C#N)cc2)CC1 |
|---|
