Introduction:Basic information about CAS 942148-30-3|Azepino[4,5-b]indole-5-carboxylic acid, 8-fluoro-1,2,3,6-tetrahydro-1,1-dimethyl-, 1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Azepino[4,5-b]indole-5-carboxylic acid, 8-fluoro-1,2,3,6-tetrahydro-1,1-dimethyl-, 1-methylethyl ester |
|---|
| CAS Number | 942148-30-3 | Molecular Weight | 316.37000 |
|---|
| Density | 1.183g/cm3 | Boiling Point | 495ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21FN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253.2ºC |
|---|
Names
| Name | Azepino[4,5-b]indole-5-carboxylic acid, 8-fluoro-1,2,3,6-tetrahydro-1,1-dimethyl-, 1-methylethyl ester |
|---|
Chemical & Physical Properties
| Density | 1.183g/cm3 |
|---|
| Boiling Point | 495ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21FN2O2 |
|---|
| Molecular Weight | 316.37000 |
|---|
| Flash Point | 253.2ºC |
|---|
| Exact Mass | 316.15900 |
|---|
| PSA | 54.12000 |
|---|
| LogP | 3.80910 |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | LCBILDCOUYKCBK-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)OC(=O)C1=CNCC(C)(C)c2c1[nH]c1cc(F)ccc21 |
|---|