Introduction：Basic information about CAS 896101-81-8|1H-Indole-3-acetonitrile, 5-methoxy-a,a-dimethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Indole-3-acetonitrile, 5-methoxy-a,a-dimethyl- |
|---|
| CAS Number | 896101-81-8 | Molecular Weight | 214.26300 |
|---|
| Density | 1.152g/cm3 | Boiling Point | 405.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.8ºC |
|---|
Names
| Name | 1H-Indole-3-acetonitrile, 5-methoxy-a,a-dimethyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.152g/cm3 |
|---|
| Boiling Point | 405.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14N2O |
|---|
| Molecular Weight | 214.26300 |
|---|
| Flash Point | 198.8ºC |
|---|
| Exact Mass | 214.11100 |
|---|
| PSA | 48.81000 |
|---|
| LogP | 2.97768 |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | ZHDVNWHEEPLIBL-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2[nH]cc(C(C)(C)C#N)c2c1 |
|---|
Synonyms
| 2-(5-methoxy-1H-indol-3-yl)-2-methylpropanonitrile |
| 2-(5-methoxy-1H-indol-3-yl)-1-(toluene-4-sulfonyl)-1H-pyrrolo[2,3-b]pyridine |
| Benzofuran,3-(2-iodoethyl)-5-methoxy |
| 2-(5-methoxy-1-benzofuran-3-yl)ethyl iodide |
