Introduction：Basic information about CAS 503559-81-7|3-Pyridinecarboxaldehyde, 5-(1-buten-1-yl)-4-[4-fluoro-2-(phenylmethoxy)phenyl]-2,6-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Pyridinecarboxaldehyde, 5-(1-buten-1-yl)-4-[4-fluoro-2-(phenylmethoxy)phenyl]-2,6-bis(1-methylethyl)- |
|---|
| CAS Number | 503559-81-7 | Molecular Weight | 445.56800 |
|---|
| Density | 1.097g/cm3 | Boiling Point | 550.5ºC at 760 mmHg |
|---|
| Molecular Formula | C29H32FNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 286.8ºC |
|---|
Names
| Name | 3-Pyridinecarboxaldehyde, 5-(1-buten-1-yl)-4-[4-fluoro-2-(phenylmethoxy)phenyl]-2,6-bis(1-methylethyl) |
|---|
Chemical & Physical Properties
| Density | 1.097g/cm3 |
|---|
| Boiling Point | 550.5ºC at 760 mmHg |
|---|
| Molecular Formula | C29H32FNO2 |
|---|
| Molecular Weight | 445.56800 |
|---|
| Flash Point | 286.8ºC |
|---|
| Exact Mass | 445.24200 |
|---|
| PSA | 39.19000 |
|---|
| LogP | 7.94920 |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | KSBATTIYZHYYFR-NTUHNPAUSA-N |
|---|
| SMILES | CCC=Cc1c(C(C)C)nc(C(C)C)c(C=O)c1-c1ccc(F)cc1OCc1ccccc1 |
|---|
