Introduction：Basic information about CAS 50583-51-2|Di-p-anisoyl-L-tartaric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Di-p-anisoyl-L-tartaric acid |
|---|
| CAS Number | 50583-51-2 | Molecular Weight | 418.351 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 681.6±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H18O10 | Melting Point | 193-195°C |
|---|
| MSDS | / | Flash Point | 241.6±25.0 °C |
|---|
Names
| Name | (-)-Bis(4-methoxybenzoyl)-L-tartaric Acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 681.6±55.0 °C at 760 mmHg |
|---|
| Melting Point | 193-195°C |
|---|
| Molecular Formula | C20H18O10 |
|---|
| Molecular Weight | 418.351 |
|---|
| Flash Point | 241.6±25.0 °C |
|---|
| Exact Mass | 418.089996 |
|---|
| PSA | 145.66000 |
|---|
| LogP | 5.97 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | KWWCVCFQHGKOMI-HZPDHXFCSA-N |
|---|
| SMILES | COc1ccc(C(=O)OC(C(=O)O)C(OC(=O)c2ccc(OC)cc2)C(=O)O)cc1 |
|---|
Safety Information
| Hazard Codes | T+,C,T |
|---|
| Risk Phrases | R14:Reacts violently with water. R26:Very Toxic by inhalation. R34:Causes burns. R37:Irritating to the respiratory system. |
|---|
| Safety Phrases | S26-S36/37/39-S38-S45 |
|---|
| RIDADR | UN 2418 2.3 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | WT4800000 |
|---|
| Hazard Class | 2.3 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Butanedioic acid, 2,3-bis[(4-methoxybenzoyl)oxy]-, (2S,3S)- |
| MFCD02682986 |
| (+)-DIBENZOYL-P-METHOXY-D-TARTARIC ACID |
| Butanedioic acid, 2,3-bis[(4-methoxybenzoyl)oxy]- |
| (2S,3S)-2,3-Bis[(4-methoxybenzoyl)oxy]succinic acid |
| (-)-Di-p-anisoyl-L-tartaric Acid |
| 2,3-bis[(4-methoxybenzoyl)oxy]butanedioic acid |
| 2,3-Bis[(4-methoxybenzoyl)oxy]succinic acid |
| (2S,3S)-2,3-Bis{[(4-methoxyphenyl)carbonyl]oxy}butanedioic acid |
| (2R,3R)-2,3-Bis((4-methoxybenzoyl)oxy)succinic acid |
| Di-p-anisoyl-L-tartaric acid |
