Introduction:Basic information about CAS 375846-25-6|tert-Butyl (E)-7-[3'-(4''-fluorophenyl)-1'-methylethyl-indol-2'-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl (E)-7-[3'-(4''-fluorophenyl)-1'-methylethyl-indol-2'-yl]-3-hydroxy-5-oxo-6-heptenoate |
|---|
| CAS Number | 375846-25-6 | Molecular Weight | 465.55600 |
|---|
| Density | 1.13 g/cm3 | Boiling Point | 647.7ºC at 760 mmHg |
|---|
| Molecular Formula | C28H32FNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 345.5ºC |
|---|
Names
| Name | tert-Butyl (E)-7-[3'-(4''-fluorophenyl)-1'-methylethyl-indol-2'-yl]-3-hydroxy-5-oxo-6-heptenoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.13 g/cm3 |
|---|
| Boiling Point | 647.7ºC at 760 mmHg |
|---|
| Molecular Formula | C28H32FNO4 |
|---|
| Molecular Weight | 465.55600 |
|---|
| Flash Point | 345.5ºC |
|---|
| Exact Mass | 465.23200 |
|---|
| PSA | 68.53000 |
|---|
| LogP | 6.09340 |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | CHEYRYWZYKYUHU-CCEZHUSRSA-N |
|---|
| SMILES | CC(C)n1c(C=CC(O)CC(=O)CC(=O)OC(C)(C)C)c(-c2ccc(F)cc2)c2ccccc21 |
|---|
Synonyms
| 7-[3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl]-5-hydroxy-3-oxo-6-heptenoic acid-1,1-dimethylethyl ester |
| tert-butyl (+/-)-(E)-7-[3-(4-fluoro-phenyl)-1-(1-methyl-ethyl)-1H-indol-2-yl]-5-hydroxy-3-oxo-hept-6-enoate |
| T-BUTYL(E)-7-[3'-(4''-FLUOROPHENYL)-1'METHYLETHYL-INDOL-2'YL]-3HYDROXY-5-OXO-6-HEPTENOATE |
| (E)-7-[3-(4-fluorophenyl)-1-isopropyl-1H-indol-2-yl]-5-hydroxy-3-oxohept-6-enoic acid tert-butyl ester |
| (+/-)-(E)-7-[3-(4-fluoro-phenyl)-1-(1-methyl-ethyl)-1H-indol-2-yl]-5-hydroxy-3-oxo-hept-6-enoic acid t-butyl ester |
| T-butyl(E)-7-[3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl]-5-hydroxy-3-oxohept-6-enoate |
| t-Butyl(E)-7-[3'-(4''-fluorophenyl)-1'methylethyl-indol-2'-yl]-3-hydroxy-5-oxo-6 |