Introduction:Basic information about CAS 4123-32-4|(2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone |
|---|
| CAS Number | 4123-32-4 | Molecular Weight | 356.44000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C22H16N2OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C22H16N2OS |
|---|
| Molecular Weight | 356.44000 |
|---|
| Exact Mass | 356.09800 |
|---|
| PSA | 70.23000 |
|---|
| LogP | 5.85770 |
|---|
| InChIKey | LQFHHNJNCSFAOJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccccc1)c1sc(Nc2ccccc2)nc1-c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| Phenyl-(4-phenyl-2-phenylamino-thiazol-5-yl)-methanone |
| (2-anilino-4-phenyl-thiazol-5-yl)-phenyl-methanone |
| 2-phenylamino-4-phenyl-5-benzoylthiazole |
| 2-N-Phenylamino-4-phenyl-5-benzoylthiazole |
| (2-anilino-4-phenyl-thiazol-5-yl)-phenyl ketone |
| (2-Anilino-4-phenyl-thiazol-5-yl)-phenyl-keton |
| 2-Anilino-5-benzoyl-4-phenylthiazol |
| 2-Phenylamino-4-phenyl-5-benzoyl-thiazol |