Introduction:Basic information about CAS 24954-67-4|4-Nitrophenethylamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Nitrophenethylamine |
|---|
| CAS Number | 24954-67-4 | Molecular Weight | 166.177 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 307.2±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 139.6±20.9 °C |
|---|
Names
| Name | 2-(4-nitrophenyl)ethanamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 307.2±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O2 |
|---|
| Molecular Weight | 166.177 |
|---|
| Flash Point | 139.6±20.9 °C |
|---|
| Exact Mass | 166.074234 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 1.19 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | IOXOZOPLBFXYLM-UHFFFAOYSA-N |
|---|
| SMILES | NCCc1ccc([N+](=O)[O-])cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2921499090 |
|---|
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-(4-Nitrophenyl)ethanamine |
| p-nitrophenylethyl amine |
| p-nitro-phenethylamine |
| 4-Nitrophenethylamine hydrochloride |
| 2-(4-nitrophenyl)ethan-1-amine |
| 4-Nitrophenethylamine |
| 4-Nitro-Phenethylamine |
| Benzeneethanamine, 4-nitro- |
| Benzeneethanamine,4-nitro |
| para-Nitrophenylethylamine |
| 2-(4-nitro-phenyl)-ethylamine |
| 2-(4-nitrophenyl)-1-ethanamine |