Introduction：Basic information about CAS 7242-16-2|(Z)-3-[(4-chlorophenyl)carbamoyl]prop-2-enoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Z)-3-[(4-chlorophenyl)carbamoyl]prop-2-enoic acid |
|---|
| CAS Number | 7242-16-2 | Molecular Weight | 225.62800 |
|---|
| Density | 1.448g/cm3 | Boiling Point | 466.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.7ºC |
|---|
Names
| Name | (Z)-4-(4-chloroanilino)-4-oxobut-2-enoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.448g/cm3 |
|---|
| Boiling Point | 466.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8ClNO3 |
|---|
| Molecular Weight | 225.62800 |
|---|
| Flash Point | 235.7ºC |
|---|
| Exact Mass | 225.01900 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 1.99230 |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | FBTQVXSNFILAQY-WAYWQWQTSA-N |
|---|
| SMILES | O=C(O)C=CC(=O)Nc1ccc(Cl)cc1 |
|---|
Synonyms
| 4'-chloromaleanilic acid |
| N-(4-Chlor-phenyl)-maleinamidsaeure |
| 3-(4-chlorophenylcarbamoyl)-Z-acrylic acid |
| p-chloromaleanilic acid |
| N-(4-chloro-phenyl)-malamic acid |
| N-(4-Chlorophenyl)Maleamic Acid |
| Maleinsaeure-mono-(4-chlor-anilid) |
