Introduction：Basic information about CAS 104086-19-3|4-Methylsulfonyl-2,2',3',4',5,5'-hexachlorobiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Methylsulfonyl-2,2',3',4',5,5'-hexachlorobiphenyl |
|---|
| CAS Number | 104086-19-3 | Molecular Weight | 438.96900 |
|---|
| Density | 1.636g/cm3 | Boiling Point | 532.7ºC at 760mmHg |
|---|
| Molecular Formula | C13H6Cl6O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 275.9ºC |
|---|
Names
| Name | 1,2,3,4-tetrachloro-5-(2,5-dichloro-4-methylsulfonylphenyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.636g/cm3 |
|---|
| Boiling Point | 532.7ºC at 760mmHg |
|---|
| Molecular Formula | C13H6Cl6O2S |
|---|
| Molecular Weight | 438.96900 |
|---|
| Flash Point | 275.9ºC |
|---|
| Exact Mass | 435.82200 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 7.75830 |
|---|
| Vapour Pressure | 6.87E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | VMAPRWPCNHOICN-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1cc(Cl)c(-c2cc(Cl)c(Cl)c(Cl)c2Cl)cc1Cl |
|---|
Synonyms
| 4-Methylsulfonyl-2,2',3',4',5,5'-hexachlorobiphenyl |
| 4'-Methylsulfonyl-2,3,4,5,2',5'-hexachlorobiphenyl |
| 2,2',3,4,5,5'-Hexachloro-4'-(methylsulfonyl)-1,1'-biphenyl |
| 1,1'-Biphenyl,2,2',3,4,5,5'-hexachloro-4'-(methylsulfonyl) |
