CAS 1785-52-0|6,11-DIHYDROXY-5,12-NAPHTHACENEDIONE
Introduction：Basic information about CAS 1785-52-0|6,11-DIHYDROXY-5,12-NAPHTHACENEDIONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6,11-DIHYDROXY-5,12-NAPHTHACENEDIONE | ||
|---|---|---|---|
| CAS Number | 1785-52-0 | Molecular Weight | 290.27000 |
| Density | 1.527g/cm3 | Boiling Point | 552.9ºC at 760mmHg |
| Molecular Formula | C18H10O4 | Melting Point | 350-351ºC(lit.) |
| MSDS | ChineseUSA | Flash Point | 302.2ºC |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | 6,11-dihydroxytetracene-5,12-dione |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.527g/cm3 |
|---|---|
| Boiling Point | 552.9ºC at 760mmHg |
| Melting Point | 350-351ºC(lit.) |
| Molecular Formula | C18H10O4 |
| Molecular Weight | 290.27000 |
| Flash Point | 302.2ºC |
| Exact Mass | 290.05800 |
| PSA | 74.60000 |
| LogP | 3.02640 |
| Vapour Pressure | 7.82E-13mmHg at 25°C |
| Index of Refraction | 1.787 |
| InChIKey | QECAURYYBPUIFF-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(O)c1ccccc1c2O |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914690090 |
Customs
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
Articles5
More Articles| Quinonoid-bridged chair-shaped dirhenium(I) metallacycles: synthesis, characterization, and spectroelectrochemical studies. Inorg. Chem. 49(22) , 10264-72, (2010) Self-assembled, chair-shaped dirhenium(I) macrocyclic compounds featuring the two different bis-chelating quinone dianions (1, L = dhnq(2-); 2, L = dhaq(2-); H(2)dhnq = 6,11-dihydroxy-5,12-naphthacene... | |
| Self-assembled half-sandwich Ir, Rh-based organometallic molecular boxes for reversible trapping of halocarbon molecules. Dalton Trans. 39(16) , 3976-84, (2010) Reactions of [Cp*MCl(mu-Cl)](2) (M = Ir or Rh) with 6,11-dihydroxy-5,12-naphthacenedione (H(2)DHNA) in the presence of base, gave the corresponding binuclear complexes [Cp*(2)M(2)(mu-DHNA)Cl(2)] (M = ... | |
| 5, 6, 11, 12-Tetrachlorotetracene, a tetracene derivative with p-stacking structure: The synthesis, crystal structure and transistor properties. Chi X, et al. Org. Electron. 9(2) , 234-40, (2008) |
Synonyms
| 5,12-dihydroxy-6,13-tetracenequinone |
| 6,11-Dihydroxy-5,12-naphthacenedione |
| 6,11-dihydroxynaphthacene-5,12-dione |
| 6,11-dihydroxy-5,12-naphthacenequinone |
| 6,11-Dihydroxy-5,11-naphthacenequinone |
| MFCD00192048 |
