Introduction：Basic information about CAS 103112-35-2|fenchlorazole-ethyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fenchlorazole-ethyl |
|---|
| CAS Number | 103112-35-2 | Molecular Weight | 403.47600 |
|---|
| Density | 1.65 g/cm3 | Boiling Point | 469.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8Cl5N3O2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 237.9ºC |
|---|
| Symbol |
GHS08, GHS09 | Signal Word | Danger |
|---|
Names
| Name | fenchlorazole-ethyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.65 g/cm3 |
|---|
| Boiling Point | 469.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8Cl5N3O2 |
|---|
| Molecular Weight | 403.47600 |
|---|
| Flash Point | 237.9ºC |
|---|
| Exact Mass | 400.90600 |
|---|
| PSA | 57.01000 |
|---|
| LogP | 4.57750 |
|---|
| Vapour Pressure | 5.35E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.645 |
|---|
| InChIKey | GMBRUAIJEFRHFQ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1nc(C(Cl)(Cl)Cl)n(-c2ccc(Cl)cc2Cl)n1 |
|---|
Safety Information
| Symbol |
GHS08, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H350-H410 |
|---|
| Precautionary Statements | P201-P273-P308 + P313-P501 |
|---|
| Personal Protective Equipment | Eyeshields;Gloves |
|---|
| RIDADR | UN3077 9 |
|---|
| RTECS | XZ4272500 |
|---|
Synonyms
| Fenchlorazole-Et |
| Fenchlorazole-ethyl |
| Fenchlorazol-ethyl |
| ethyl 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1H-1,2,4-triazole-3-carboxylate |
| ethyl 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylate |
| ethyl 1-(2,4-dichlorophenyl)-5-trichloromethyl-1H-1,2,4-triazole-3-carboxylate |
