Introduction：Basic information about CAS 66389-80-8|tert-butyl 4-cyanobenzylcarbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl 4-cyanobenzylcarbamate |
|---|
| CAS Number | 66389-80-8 | Molecular Weight | 232.278 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 392.9±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.4±25.9 °C |
|---|
Names
| Name | tert-butyl N-[(4-cyanophenyl)methyl]carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 392.9±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16N2O2 |
|---|
| Molecular Weight | 232.278 |
|---|
| Flash Point | 191.4±25.9 °C |
|---|
| Exact Mass | 232.121185 |
|---|
| PSA | 62.12000 |
|---|
| LogP | 2.33 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | NCGBJBDHEYDWEC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C#N)cc1 |
|---|
Synonyms
| 4-BOC-AMINOMETHYL-BENZONITRILE |
| Boc-4-cyanobenzylamine |
| 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate |
| Boc-NH-CH2C6H4-4-CN |
| Carbamic acid, N-[(4-cyanophenyl)methyl]-, 1,1-dimethylethyl ester |
| tert-butyl 4-cyanobenzylcarbaMate |
| 4-(Boc-aminomethyl)benzonitrile |
