Introduction:Basic information about CAS 17413-77-3|AKOS B013930, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | AKOS B013930 |
|---|
| CAS Number | 17413-77-3 | Molecular Weight | 208.25400 |
|---|
| Density | 1.093g/cm3 | Boiling Point | 324.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 120.3ºC |
|---|
Names
| Name | 2-(4-ethylphenoxy)-2-methylpropanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.093g/cm3 |
|---|
| Boiling Point | 324.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16O3 |
|---|
| Molecular Weight | 208.25400 |
|---|
| Flash Point | 120.3ºC |
|---|
| Exact Mass | 208.11000 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.49100 |
|---|
| Vapour Pressure | 0.000102mmHg at 25°C |
|---|
| Index of Refraction | 1.52 |
|---|
| InChIKey | HHHGHRABZLIUAT-UHFFFAOYSA-N |
|---|
| SMILES | CCc1ccc(OC(C)(C)C(=O)O)cc1 |
|---|
Safety Information