Introduction:Basic information about CAS 221018-03-7|3',5'-DIFLUORO-[1,1'-BIPHENYL]-4-CARBALDEHYDE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3',5'-DIFLUORO-[1,1'-BIPHENYL]-4-CARBALDEHYDE |
|---|
| CAS Number | 221018-03-7 | Molecular Weight | 218.19900 |
|---|
| Density | 1.248g/cm3 | Boiling Point | 322.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8F2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 123.8ºC |
|---|
Names
| Name | 4-(3,5-difluorophenyl)benzaldehyde |
|---|
Chemical & Physical Properties
| Density | 1.248g/cm3 |
|---|
| Boiling Point | 322.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8F2O |
|---|
| Molecular Weight | 218.19900 |
|---|
| Flash Point | 123.8ºC |
|---|
| Exact Mass | 218.05400 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.44430 |
|---|
| Vapour Pressure | 0.000272mmHg at 25°C |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | KKOQMGVTGKBJBL-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1ccc(-c2cc(F)cc(F)c2)cc1 |
|---|