Introduction:Basic information about CAS 37148-49-5|Ethanone,1-(4-amino-3,5-dichlorophenyl)-2-[(1,1-dimethylethyl)amino]-, hydrochloride(, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethanone,1-(4-amino-3,5-dichlorophenyl)-2-[(1,1-dimethylethyl)amino]-, hydrochloride(1:?) |
|---|
| CAS Number | 37148-49-5 | Molecular Weight | 311.63500 |
|---|
| Density | / | Boiling Point | 415.9ºC at 760mmHg |
|---|
| Molecular Formula | C12H17Cl3N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.3ºC |
|---|
Names
| Name | 4-Amino-3,5-dichlor-α-tert.-butylamino-acetophenon HCl |
|---|
Chemical & Physical Properties
| Boiling Point | 415.9ºC at 760mmHg |
|---|
| Molecular Formula | C12H17Cl3N2O |
|---|
| Molecular Weight | 311.63500 |
|---|
| Flash Point | 205.3ºC |
|---|
| Exact Mass | 310.04100 |
|---|
| PSA | 55.12000 |
|---|
| LogP | 4.92050 |
|---|
| InChIKey | VCMBTLCRANMPCO-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)NCC(=O)c1cc(Cl)c(N)c(Cl)c1.Cl |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|