Introduction：Basic information about CAS 56693-15-3|Terciprazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Terciprazine |
|---|
| CAS Number | 56693-15-3 | Molecular Weight | 410.47300 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 522ºC at 760 mmHg |
|---|
| Molecular Formula | C22H29F3N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 269.5ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 522ºC at 760 mmHg |
|---|
| Molecular Formula | C22H29F3N2O2 |
|---|
| Molecular Weight | 410.47300 |
|---|
| Flash Point | 269.5ºC |
|---|
| Exact Mass | 410.21800 |
|---|
| PSA | 35.94000 |
|---|
| LogP | 3.54390 |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | SDKXUWMRKYQIFU-UHFFFAOYSA-N |
|---|
| SMILES | C#CC1(OCC(O)CN2CCN(c3cccc(C(F)(F)F)c3)CC2)CCCCC1 |
|---|
