Introduction：Basic information about CAS 105102-21-4|Torbafylline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Torbafylline |
|---|
| CAS Number | 105102-21-4 | Molecular Weight | 338.40200 |
|---|
| Density | 1.25g/cm3 | Boiling Point | 534.7ºC at 760mmHg |
|---|
| Molecular Formula | C16H26N4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 277.2ºC |
|---|
Names
| Name | 7-(ethoxymethyl)-1-(5-hydroxy-5-methylhexyl)-3-methylpurine-2,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|
| Boiling Point | 534.7ºC at 760mmHg |
|---|
| Molecular Formula | C16H26N4O4 |
|---|
| Molecular Weight | 338.40200 |
|---|
| Flash Point | 277.2ºC |
|---|
| Exact Mass | 338.19500 |
|---|
| PSA | 91.28000 |
|---|
| LogP | 0.83190 |
|---|
| Vapour Pressure | 2.91E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | QSXXLDDWVCEBFP-UHFFFAOYSA-N |
|---|
| SMILES | CCOCn1cnc2c1c(=O)n(CCCCC(C)(C)O)c(=O)n2C |
|---|
Synonyms
| Torbafyllinum |
| UNII-65O78F9T1W |
| Torbafylline |
| Torbafilina |
