Introduction：Basic information about CAS 29713-15-3|1,3-adamantanedicarbonyl dichloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-adamantanedicarbonyl dichloride |
|---|
| CAS Number | 29713-15-3 | Molecular Weight | 261.14400 |
|---|
| Density | 1.441 | Boiling Point | 318ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14Cl2O2 | Melting Point | 89-90ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | adamantane-1,3-dicarbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.441 |
|---|
| Boiling Point | 318ºC at 760 mmHg |
|---|
| Melting Point | 89-90ºC |
|---|
| Molecular Formula | C12H14Cl2O2 |
|---|
| Molecular Weight | 261.14400 |
|---|
| Exact Mass | 260.03700 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 3.10380 |
|---|
| Vapour Pressure | 0.000372mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | LKRUZYNPJUZODM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)C12CC3CC(C1)CC(C(=O)Cl)(C3)C2 |
|---|
Synonyms
| 1,3-Adamantanedicarbonyl chloride |
| adamantane-1,3-dicarboxylic acid dichloride |
| adamantane-1,3-dicarbonyl dichloride |
| 1,3-adamantane dicarbonyl dichloride |
| 1,3-diadamantanedicarbonyl dichloride |
| 1,3-Ad(COCl)2 |
| 1,3-adamantanedicarbonyl dichloride |
