Introduction:Basic information about CAS 107264-00-6|1-Fluoro-2,4,6-trimethylpyridinium Trifluoromethanesulfonate [Fluorinating Reagent], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Fluoro-2,4,6-trimethylpyridinium Trifluoromethanesulfonate [Fluorinating Reagent] |
|---|
| CAS Number | 107264-00-6 | Molecular Weight | 289.247 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H11F4NO3S | Melting Point | 162-165 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | 1-Fluoro-2,4,6-Trimethylpyridinium Triflate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 162-165 °C(lit.) |
|---|
| Molecular Formula | C9H11F4NO3S |
|---|
| Molecular Weight | 289.247 |
|---|
| Exact Mass | 289.039581 |
|---|
| PSA | 69.46000 |
|---|
| LogP | 2.76410 |
|---|
| InChIKey | PRIGFEJKMMRJSF-UHFFFAOYSA-M |
|---|
| SMILES | Cc1cc(C)[n+](F)c(C)c1.O=S(=O)([O-])C(F)(F)F |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S27-S28-S36/37/39 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-Fluoro-2,4,6-trimethylpyridinium trifluoromethanesulfonate |
| 1-Fluoro-2,4,6-trimethylpyridinium Triflate |
| N-Fluoro-2,4,6-trimethylpyridinium trifluoromethanesulfonate |
| 1-Fluoro-sym-collidinium triflate |
| MFCD00067525 |
| 1-fluoro-2,4,6-trimethylpyridin-1-ium,trifluoromethanesulfonate |