Introduction:Basic information about CAS 81118-92-5|2-Methoxy-5-nitrobenzene-1-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methoxy-5-nitrobenzene-1-sulfonyl chloride |
|---|
| CAS Number | 81118-92-5 | Molecular Weight | 251.64400 |
|---|
| Density | 1.554g/cm3 | Boiling Point | 407.232ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6ClNO5S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 200.087ºC |
|---|
Names
| Name | 2-methoxy-5-nitrobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.554g/cm3 |
|---|
| Boiling Point | 407.232ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6ClNO5S |
|---|
| Molecular Weight | 251.64400 |
|---|
| Flash Point | 200.087ºC |
|---|
| Exact Mass | 250.96600 |
|---|
| PSA | 97.57000 |
|---|
| LogP | 3.13490 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | DSSUHBJSDMHACJ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc([N+](=O)[O-])cc1S(=O)(=O)Cl |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2-(methyloxy)-5-nitrobenzenesulfonyl chloride |
| 2-methoxy-5-nitro-benzenesulfonyl chloride |
| 2-methoxy-5-nitro-benzenesulphonyl chloride |
| 2-Methoxy-5-nitro-benzolsulfonylchlorid |