Introduction：Basic information about CAS 17624-26-9|1H-Isoindole-1,3(2H)-dione,2-[2-(2-pyridinyl)ethyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Isoindole-1,3(2H)-dione,2-[2-(2-pyridinyl)ethyl]- |
|---|
| CAS Number | 17624-26-9 | Molecular Weight | 252.26800 |
|---|
| Density | 1.299g/cm3 | Boiling Point | 227ºC 10mm |
|---|
| Molecular Formula | C15H12N2O2 | Melting Point | 89-92ºC |
|---|
| MSDS | / | Flash Point | 207.3ºC |
|---|
Names
| Name | 2-(2-pyridin-2-ylethyl)isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.299g/cm3 |
|---|
| Boiling Point | 227ºC 10mm |
|---|
| Melting Point | 89-92ºC |
|---|
| Molecular Formula | C15H12N2O2 |
|---|
| Molecular Weight | 252.26800 |
|---|
| Flash Point | 207.3ºC |
|---|
| Exact Mass | 252.09000 |
|---|
| PSA | 50.27000 |
|---|
| LogP | 1.85820 |
|---|
| Vapour Pressure | 3.09E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | XDSOQPQMYBPJND-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)N1CCc1ccccn1 |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| N-(2-[2]Pyridyl-aethyl)-phthalimid |
| 2-(2-aminoethyl)-N-phthalimidopyridine |
| 2-(2-Pyridin-2-yl-ethyl)-isoindol-1,3-dione |
| N-(2-[2]pyridyl-ethyl)-phthalimide |
| 2-[2-(pyridin-2-yl)ethyl]-1h-isoindole-1,3(2h)-dione |
| MFCD03368393 |
| 2-[2-(2-pyridinyl)ethyl]-1H-isoindole-1,3(2H)-dione |
| N-2-(2-PYRIDYLETHYL)PHTHALIMIDE |
| N-(2-pyridin-2-yl-ethyl)-phthalimide |
| 2-(2-(pyridin-2-yl)ethyl)isoindoline-1,3-dione |
| N-<2-(2-Pyridyl)-ethyl>phthalimid |
