Introduction：Basic information about CAS 173089-80-0|6-quinolinyl trifluoromethanesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-quinolinyl trifluoromethanesulfonate |
|---|
| CAS Number | 173089-80-0 | Molecular Weight | 277.22000 |
|---|
| Density | 1.556g/cm3 | Boiling Point | 354.743ºC at 760 mmHg |
|---|
| Molecular Formula | C10H6F3NO3S | Melting Point | 34-38ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | >230 °F |
|---|
| Symbol |
GHS06 | Signal Word | Danger |
|---|
Names
| Name | quinolin-6-yl trifluoromethanesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.556g/cm3 |
|---|
| Boiling Point | 354.743ºC at 760 mmHg |
|---|
| Melting Point | 34-38ºC(lit.) |
|---|
| Molecular Formula | C10H6F3NO3S |
|---|
| Molecular Weight | 277.22000 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 277.00200 |
|---|
| PSA | 64.64000 |
|---|
| LogP | 3.54400 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.56 |
|---|
| InChIKey | TVYXNKUMLWUQPV-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Oc1ccc2ncccc2c1)C(F)(F)F |
|---|
Safety Information
| Symbol |
GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H300-H315-H319 |
|---|
| Precautionary Statements | P264-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T |
|---|
| Risk Phrases | R25 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | UN 2811 6.1/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Hazard Class | 6.1 |
|---|
Synonyms
| quinolin-6-yl triflate |
| 6-trifluoromethanesulfonyloxyquinoline |
| 6-quinolinyl trifluoromethanesulfonate |
| trifluoro-methanesulfonic acid quinolin-6-yl ester |
| MFCD05865187 |
| quinoline-6-triflate |
