Introduction：Basic information about CAS 17115-47-8|tetrahydrothiophene-3-sulfonyl chloride 1,1-dioxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tetrahydrothiophene-3-sulfonyl chloride 1,1-dioxide |
|---|
| CAS Number | 17115-47-8 | Molecular Weight | 218.67900 |
|---|
| Density | 1.7g/cm3 | Boiling Point | 446.2ºC at 760 mmHg |
|---|
| Molecular Formula | C4H7ClO4S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 223.7ºC |
|---|
Names
| Name | 1,1-dioxothiolane-3-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7g/cm3 |
|---|
| Boiling Point | 446.2ºC at 760 mmHg |
|---|
| Molecular Formula | C4H7ClO4S2 |
|---|
| Molecular Weight | 218.67900 |
|---|
| Flash Point | 223.7ºC |
|---|
| Exact Mass | 217.94700 |
|---|
| PSA | 85.04000 |
|---|
| LogP | 1.90370 |
|---|
| Vapour Pressure | 9.75E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.55 |
|---|
| InChIKey | AOAOPMCGCFWIHW-UHFFFAOYSA-N |
|---|
| SMILES | O=S1(=O)CCC(S(=O)(=O)Cl)C1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Tetrahydro-3-thiophenesulfonyl chloride 1,1-dioxide |
| sulfonyl chloride |
| 1,1-dioxo-tetrahydrothiophene-3-sulfonyl chloride |
| Sulfolan-3-sulfonylchlorid |
| tetrahydrothiophene-3-sulfonylchloride 1,1-dioxide |
| 3-(chlorosulfonyl)thiolane-1,1-dione |
| 1,1-Dioxo-tetrahydro-1lambda*6*-thiophene-3-sulfonyl chloride |
