Introduction：Basic information about CAS 321-50-6|4-Fluoroisatoic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Fluoroisatoic anhydride |
|---|
| CAS Number | 321-50-6 | Molecular Weight | 181.12100 |
|---|
| Density | 1.502g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H4FNO3 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 7-fluoro-1H-3,1-benzoxazine-2,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.502g/cm3 |
|---|
| Molecular Formula | C8H4FNO3 |
|---|
| Molecular Weight | 181.12100 |
|---|
| Exact Mass | 181.01800 |
|---|
| PSA | 63.07000 |
|---|
| LogP | 0.62040 |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | JEVWCMDHSLNNDR-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]c2cc(F)ccc2c(=O)o1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| fluorobenzoxazinedione |
| 7-Fluoroisatoic anhydride |
| 7-fluoro-1H-benz[d][1,3]oxazine-2,4-dione |
| 7-fluoro-1,2-dihydro-3,1-4H-benzoxazine-2,4-dione |
| 7-fluoro-2H-3,1-benzoxazine-2,4(1H)-dione |
| 7-fluoro-1h-benzo[d][1,3]oxazine-2,4-dione |
| 7-fluorobenzo[d][1,3]oxazine-2,4-dione |
| 7-Fluor-1H-benz[d][1,3]oxazin-2,4-dion |
| 4-Fluoroisatoic anhydride |
