Introduction：Basic information about CAS 2369-12-2|3-Fluoro-5-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Fluoro-5-nitroaniline |
|---|
| CAS Number | 2369-12-2 | Molecular Weight | 156.115 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 314.3±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H5FN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 143.9±22.3 °C |
|---|
Names
| Name | 3-fluoro-5-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 314.3±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H5FN2O2 |
|---|
| Molecular Weight | 156.115 |
|---|
| Flash Point | 143.9±22.3 °C |
|---|
| Exact Mass | 156.033508 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 1.72 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | OPMFAZASMJCCOQ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(F)cc([N+](=O)[O-])c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2921420090 |
|---|
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 5-fluoro-3-nitroaniline |
| 3-Fluor-5-nitro-anilin |
| Benzenamine, 3-fluoro-5-nitro- |
| 3-nitro-5-fluoroaniline |
| 3-fluoro-5-nitrobenzenamine |
| EINECS 219-129-0 |
| 3-Fluoro-5-nitro-phenylamine |
| 3-Fluoro-5-nitroaniline |
| 3-fluoro-5-nitro-aniline |
