Introduction：Basic information about CAS 6279-89-6|Benzene,5-(1,1-dimethylethyl)-1,3-dimethyl-2-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,5-(1,1-dimethylethyl)-1,3-dimethyl-2-nitro- |
|---|
| CAS Number | 6279-89-6 | Molecular Weight | 207.26900 |
|---|
| Density | 1.033g/cm3 | Boiling Point | 279.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H17NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 106.5ºC |
|---|
Names
| Name | 5-tert-butyl-1,3-dimethyl-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.033g/cm3 |
|---|
| Boiling Point | 279.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H17NO2 |
|---|
| Molecular Weight | 207.26900 |
|---|
| Flash Point | 106.5ºC |
|---|
| Exact Mass | 207.12600 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 4.03230 |
|---|
| Index of Refraction | 1.518 |
|---|
| InChIKey | NZAWLDGUWOQFQA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2904209090 |
|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 4-tert-butyl-2,6-dimethylnitrobenzene |
| 1-nitro-4-tert-butyl-2,6-dimethylbenzene |
| 2,6-Dimethyl-4-tert.-butyl-nitrobenzen |
| 1,3-dimethyl-2-nitro-5-t-butylbenzene |
| 2-Nitro-1,3-dimethyl-5-tert-butylbenzen |
| 5-tert-Butyl-1,3-dimethyl-2-nitro-benzol |
| 5-tert-butyl-1,3-dimethyl-2-nitro-benzene |
