Introduction：Basic information about CAS 6273-45-6|4-(4-chlorophenyl)-4-oxo-2-phenyl-butanenitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-chlorophenyl)-4-oxo-2-phenyl-butanenitrile |
|---|
| CAS Number | 6273-45-6 | Molecular Weight | 269.72600 |
|---|
| Density | 1.221g/cm3 | Boiling Point | 466.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H12ClNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.7ºC |
|---|
Names
| Name | 4-(4-chlorophenyl)-4-oxo-2-phenylbutanenitrile |
|---|
Chemical & Physical Properties
| Density | 1.221g/cm3 |
|---|
| Boiling Point | 466.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H12ClNO |
|---|
| Molecular Weight | 269.72600 |
|---|
| Flash Point | 235.7ºC |
|---|
| Exact Mass | 269.06100 |
|---|
| PSA | 40.86000 |
|---|
| LogP | 4.22018 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | MLVQTZJXXMILIV-UHFFFAOYSA-N |
|---|
| SMILES | N#CC(CC(=O)c1ccc(Cl)cc1)c1ccccc1 |
|---|
